About CID 58273078
CID 58273078 (PubChem CID 58273078) has the molecular formula C49H40N2
and a molecular weight of 656.87 g/mol.
Molecular Properties
| Compound Name | CID 58273078 |
| PubChem CID | 58273078 |
| Molecular Formula | C49H40N2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | — |
| SMILES | [C](N1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12)N1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C49H40N2/c1-5-21-38-34(13-1)17-9-25-42(38)46-29-30-47(43-26-10-18-35-14-2-6-22-39(35)43)50(46)33-51-48(44-27-11-19-36-15-3-7-23-40(36)44)31-32-49(51)45-28-12-20-37-16-4-8-24-41(37)45/h1-28,46-49H,29-32H2/t46-,47-,48-,49-/m0/s1 |
| InChIKey | FKEGPUQOPLSDDG-HVRJTYTESA-N |
| XLogP | 12.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58273078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58273078?
The IUPAC name of CID 58273078 (CID 58273078) is not available.
What is the SMILES notation for CID 58273078?
The canonical SMILES for CID 58273078 is [C](N1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12)N1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12.
What is the InChIKey of CID 58273078?
The InChIKey is FKEGPUQOPLSDDG-HVRJTYTESA-N. The full InChI is InChI=1S/C49H40N2/c1-5-21-38-34(13-1)17-9-25-42(38)46-29-30-47(43-26-10-18-35-14-2-6-22-39(35)43)50(46)33-51-48(44-27-11-19-36-15-3-7-23-40(36)44)31-32-49(51)45-28-12-20-37-16-4-8-24-41(37)45/h1-28,46-49H,29-32H2/t46-,47-,48-,49-/m0/s1.
What are the key properties of CID 58273078?
CID 58273078 has a molecular weight of 656.87 g/mol, XLogP of 12.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58273078 is sourced from PubChem (CID 58273078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).