C32H25F11S5 — CID 58273168
2-[5-[5-(2,2,4,4,6,6,6-heptafluorohexyl)thiophen-2-yl]thiophen-2-yl]-5-[5-[5-(2,2,4,4-tetrafluorohexyl)thiophen-2-yl]thiophen-2-yl]thiophene (PubChem CID 58273168) has the molecular formula C32H25F11S5 and a molecular weight of 778.87 g/mol. Its IUPAC name is 2-[5-[5-(2,2,4,4,6,6,6-heptafluorohexyl)thiophen-2-yl]thiophen-2-yl]-5-[5-[5-(2,2,4,4-tetrafluorohexyl)thiophen-2-yl]thiophen-2-yl]thiophene.
| Compound Name | 2-[5-[5-(2,2,4,4,6,6,6-heptafluorohexyl)thiophen-2-yl]thiophen-2-yl]-5-[5-[5-(2,2,4,4-tetrafluorohexyl)thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 58273168 |
| Molecular Formula | C32H25F11S5 |
| Molecular Weight | 778.87 g/mol |
| Exact Mass | 778.04 |
| IUPAC Name | 2-[5-[5-(2,2,4,4,6,6,6-heptafluorohexyl)thiophen-2-yl]thiophen-2-yl]-5-[5-[5-(2,2,4,4-tetrafluorohexyl)thiophen-2-yl]thiophen-2-yl]thiophene |
| SMILES | CCC(F)(F)CC(F)(F)Cc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(CC(F)(F)CC(F)(F)CC(F)(F)F)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C32H25F11S5/c1-2-28(33,34)15-29(35,36)13-18-3-5-20(44-18)22-7-9-24(46-22)26-11-12-27(48-26)25-10-8-23(47-25)21-6-4-19(45-21)14-30(37,38)16-31(39,40)17-32(41,42)43/h3-12H,2,13-17H2,1H3 |
| InChIKey | FJYWLXRQLZOCNI-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.87 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |