About 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene
5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene (PubChem CID 58273356) has the molecular formula C17H13F3
and a molecular weight of 274.29 g/mol. Its IUPAC name is 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene.
Molecular Properties
| Compound Name | 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene |
| PubChem CID | 58273356 |
| Molecular Formula | C17H13F3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene |
| SMILES | Fc1cc(-c2ccc(C3=CCCC3)cc2)cc(F)c1F |
| InChI | InChI=1S/C17H13F3/c18-15-9-14(10-16(19)17(15)20)13-7-5-12(6-8-13)11-3-1-2-4-11/h3,5-10H,1-2,4H2 |
| InChIKey | KWOCBIAHXKUAIP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene?
The IUPAC name of 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene (CID 58273356) is 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene.
What is the SMILES notation for 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene?
The canonical SMILES for 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene is Fc1cc(-c2ccc(C3=CCCC3)cc2)cc(F)c1F.
What is the InChIKey of 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene?
The InChIKey is KWOCBIAHXKUAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3/c18-15-9-14(10-16(19)17(15)20)13-7-5-12(6-8-13)11-3-1-2-4-11/h3,5-10H,1-2,4H2.
What are the key properties of 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene?
5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene has a molecular weight of 274.29 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(cyclopenten-1-yl)phenyl]-1,2,3-trifluorobenzene is sourced from PubChem (CID 58273356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).