C37H38BBrN2 — CID 58273373
(3-bromo-2,4,6-trimethylphenyl)-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane (PubChem CID 58273373) has the molecular formula C37H38BBrN2 and a molecular weight of 601.44 g/mol. Its IUPAC name is (3-bromo-2,4,6-trimethylphenyl)-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane.
| Compound Name | (3-bromo-2,4,6-trimethylphenyl)-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane |
|---|---|
| PubChem CID | 58273373 |
| Molecular Formula | C37H38BBrN2 |
| Molecular Weight | 601.44 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | (3-bromo-2,4,6-trimethylphenyl)-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)c(-c3cccnc3)c2C)c2c(C)cc(C)c(-c3cccnc3)c2C)c(C)c1Br |
| InChI | InChI=1S/C37H38BBrN2/c1-21-16-23(3)34(27(7)32(21)30-12-10-14-40-19-30)38(36-25(5)18-26(6)37(39)29(36)9)35-24(4)17-22(2)33(28(35)8)31-13-11-15-41-20-31/h10-20H,1-9H3 |
| InChIKey | WJUNDMIFQSYLHK-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.44 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|