C30H27N3O3 — CID 58273416
1,3,5-tris[(E)-3-phenylprop-2-enyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 58273416) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 1,3,5-tris[(E)-3-phenylprop-2-enyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[(E)-3-phenylprop-2-enyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58273416 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1,3,5-tris[(E)-3-phenylprop-2-enyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(C/C=C/c2ccccc2)c(=O)n(C/C=C/c2ccccc2)c(=O)n1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H27N3O3/c34-28-31(22-10-19-25-13-4-1-5-14-25)29(35)33(24-12-21-27-17-8-3-9-18-27)30(36)32(28)23-11-20-26-15-6-2-7-16-26/h1-21H,22-24H2/b19-10+,20-11+,21-12+ |
| InChIKey | GTKNJXQIYBVJGL-AUCPOXKISA-N |
| XLogP | 4.31 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |