C64H72N2S9 — CID 58273783
1,4-bis[4-hexyl-5-[5-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thieno[3,4-d]pyridazine (PubChem CID 58273783) has the molecular formula C64H72N2S9 and a molecular weight of 1157.90 g/mol. Its IUPAC name is 1,4-bis[4-hexyl-5-[5-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thieno[3,4-d]pyridazine.
| Compound Name | 1,4-bis[4-hexyl-5-[5-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thieno[3,4-d]pyridazine |
|---|---|
| PubChem CID | 58273783 |
| Molecular Formula | C64H72N2S9 |
| Molecular Weight | 1157.90 g/mol |
| Exact Mass | 1156.32 |
| IUPAC Name | 1,4-bis[4-hexyl-5-[5-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thieno[3,4-d]pyridazine |
| SMILES | CCCCCCc1cc(C)sc1-c1ccc(-c2ccc(-c3sc(-c4nnc(-c5cc(CCCCCC)c(-c6ccc(-c7ccc(-c8sc(C)cc8CCCCCC)s7)s6)s5)c5cscc45)cc3CCCCCC)s2)s1 |
| InChI | InChI=1S/C64H72N2S9/c1-7-11-15-19-23-43-35-41(5)68-61(43)53-31-27-49(70-53)51-29-33-55(72-51)63-45(25-21-17-13-9-3)37-57(74-63)59-47-39-67-40-48(47)60(66-65-59)58-38-46(26-22-18-14-10-4)64(75-58)56-34-30-52(73-56)50-28-32-54(71-50)62-44(36-42(6)69-62)24-20-16-12-8-2/h27-40H,7-26H2,1-6H3 |
| InChIKey | DSAIDEWDFYCQJY-UHFFFAOYSA-N |
| XLogP | 24.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1157.90 |
| LogP ≤ 5 | 24.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|