C57H36N4 — CID 58273823
2-[2'-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine (PubChem CID 58273823) has the molecular formula C57H36N4 and a molecular weight of 776.94 g/mol. Its IUPAC name is 2-[2'-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[2'-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 58273823 |
| Molecular Formula | C57H36N4 |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.29 |
| IUPAC Name | 2-[2'-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5-4)c4ccccc4-c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc43)n2)cc1 |
| InChI | InChI=1S/C57H36N4/c1-5-17-37(18-6-1)51-35-52(38-19-7-2-8-20-38)59-55(58-51)41-29-31-45-43-25-13-15-27-47(43)57(49(45)33-41)48-28-16-14-26-44(48)46-32-30-42(34-50(46)57)56-60-53(39-21-9-3-10-22-39)36-54(61-56)40-23-11-4-12-24-40/h1-36H |
| InChIKey | NOIYFDFEDRSQQH-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |