C17H15Cl3N4O — CID 58274158
3-ethyl-2-[3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enylidene]-1,3-benzoxazole (PubChem CID 58274158) has the molecular formula C17H15Cl3N4O and a molecular weight of 397.69 g/mol. Its IUPAC name is 3-ethyl-2-[3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enylidene]-1,3-benzoxazole.
| Compound Name | 3-ethyl-2-[3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enylidene]-1,3-benzoxazole |
|---|---|
| PubChem CID | 58274158 |
| Molecular Formula | C17H15Cl3N4O |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 3-ethyl-2-[3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enylidene]-1,3-benzoxazole |
| SMILES | CCN1C(=CC=Cc2nc(C)nc(C(Cl)(Cl)Cl)n2)Oc2ccccc21 |
| InChI | InChI=1S/C17H15Cl3N4O/c1-3-24-12-7-4-5-8-13(12)25-15(24)10-6-9-14-21-11(2)22-16(23-14)17(18,19)20/h4-10H,3H2,1-2H3 |
| InChIKey | ACAUSZGRBTYCHC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|