C20H18ClF2N3O2S — CID 58274609
1-[(2S,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone (PubChem CID 58274609) has the molecular formula C20H18ClF2N3O2S and a molecular weight of 437.90 g/mol. Its IUPAC name is 1-[(2S,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone.
| Compound Name | 1-[(2S,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
|---|---|
| PubChem CID | 58274609 |
| Molecular Formula | C20H18ClF2N3O2S |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 1-[(2S,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)S[C@@]12c1cc(Cl)ccc1OC[C@H]2CCN |
| InChI | InChI=1S/C20H18ClF2N3O2S/c1-11(27)26-20(29-19(25-26)15-9-14(22)3-4-17(15)23)12(6-7-24)10-28-18-5-2-13(21)8-16(18)20/h2-5,8-9,12H,6-7,10,24H2,1H3/t12-,20+/m1/s1 |
| InChIKey | ZTLKHUMRYPYMTA-ODXCJYRJSA-N |
| XLogP | 4.09 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |