C21H21F2N3O2S — CID 58274649
1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-4-(methylamino)butan-1-one (PubChem CID 58274649) has the molecular formula C21H21F2N3O2S and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-4-(methylamino)butan-1-one.
| Compound Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-4-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 58274649 |
| Molecular Formula | C21H21F2N3O2S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-4-(methylamino)butan-1-one |
| SMILES | CNCCCC(=O)N1N=C(c2cc(F)ccc2F)SC12CCOc1ccccc12 |
| InChI | InChI=1S/C21H21F2N3O2S/c1-24-11-4-7-19(27)26-21(10-12-28-18-6-3-2-5-16(18)21)29-20(25-26)15-13-14(22)8-9-17(15)23/h2-3,5-6,8-9,13,24H,4,7,10-12H2,1H3 |
| InChIKey | KSHNRZSDLOVYHT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|