C14H16F9NO6 — CID 58275074
2-[carboxymethyl-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetic acid (PubChem CID 58275074) has the molecular formula C14H16F9NO6 and a molecular weight of 465.27 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 58275074 |
| Molecular Formula | C14H16F9NO6 |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-[carboxymethyl-[2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C14H16F9NO6/c15-12(16,17)4-11(5-13(18,19)20,6-14(21,22)23)7-30-3-8(25)24(1-9(26)27)2-10(28)29/h1-7H2,(H,26,27)(H,28,29) |
| InChIKey | STMWFOOFSFUXKY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |