C12H11F15O — CID 58275076
3-ethyl-1,1,1,5,5,5-hexafluoro-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]pentane (PubChem CID 58275076) has the molecular formula C12H11F15O and a molecular weight of 456.19 g/mol. Its IUPAC name is 3-ethyl-1,1,1,5,5,5-hexafluoro-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]pentane.
| Compound Name | 3-ethyl-1,1,1,5,5,5-hexafluoro-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]pentane |
|---|---|
| PubChem CID | 58275076 |
| Molecular Formula | C12H11F15O |
| Molecular Weight | 456.19 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 3-ethyl-1,1,1,5,5,5-hexafluoro-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]pentane |
| SMILES | CCC(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C12H11F15O/c1-2-6(3-7(13,14)15,4-8(16,17)18)5-28-9(10(19,20)21,11(22,23)24)12(25,26)27/h2-5H2,1H3 |
| InChIKey | FQBUBAOALCKHOL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.19 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |