C20H22O9 — CID 58275187
2-(6-ethoxy-6-oxohexoxy)-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid (PubChem CID 58275187) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-(6-ethoxy-6-oxohexoxy)-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid.
| Compound Name | 2-(6-ethoxy-6-oxohexoxy)-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid |
|---|---|
| PubChem CID | 58275187 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(6-ethoxy-6-oxohexoxy)-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid |
| SMILES | CCOC(=O)CCCCCOc1cc2cc(C(=O)O)cc(=O)c(O)c2c(O)c1O |
| InChI | InChI=1S/C20H22O9/c1-2-28-15(22)6-4-3-5-7-29-14-10-11-8-12(20(26)27)9-13(21)17(23)16(11)19(25)18(14)24/h8-10,24-25H,2-7H2,1H3,(H,21,23)(H,26,27) |
| InChIKey | IUOSGYBULPCCTI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|