C19H34F2O — CID 58275560
1-[(E)-5,5-difluoro-6,6-dimethylhept-3-enyl]-1-(propan-2-yloxymethyl)cyclohexane (PubChem CID 58275560) has the molecular formula C19H34F2O and a molecular weight of 316.48 g/mol. Its IUPAC name is 1-[(E)-5,5-difluoro-6,6-dimethylhept-3-enyl]-1-(propan-2-yloxymethyl)cyclohexane.
| Compound Name | 1-[(E)-5,5-difluoro-6,6-dimethylhept-3-enyl]-1-(propan-2-yloxymethyl)cyclohexane |
|---|---|
| PubChem CID | 58275560 |
| Molecular Formula | C19H34F2O |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-[(E)-5,5-difluoro-6,6-dimethylhept-3-enyl]-1-(propan-2-yloxymethyl)cyclohexane |
| SMILES | CC(C)OCC1(CC/C=C/C(F)(F)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C19H34F2O/c1-16(2)22-15-18(11-7-6-8-12-18)13-9-10-14-19(20,21)17(3,4)5/h10,14,16H,6-9,11-13,15H2,1-5H3/b14-10+ |
| InChIKey | AYPFBUHIKASWOO-GXDHUFHOSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|