About (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene
(E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene (PubChem CID 58275582) has the molecular formula C14H26F2O
and a molecular weight of 248.36 g/mol. Its IUPAC name is (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene.
Molecular Properties
| Compound Name | (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene |
| PubChem CID | 58275582 |
| Molecular Formula | C14H26F2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene |
| SMILES | CC(C)CCCC/C=C/C(F)(F)COC(C)C |
| InChI | InChI=1S/C14H26F2O/c1-12(2)9-7-5-6-8-10-14(15,16)11-17-13(3)4/h8,10,12-13H,5-7,9,11H2,1-4H3/b10-8+ |
| InChIKey | QTPIHMOKDYWYTL-CSKARUKUSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene?
The IUPAC name of (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene (CID 58275582) is (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene.
What is the SMILES notation for (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene?
The canonical SMILES for (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene is CC(C)CCCC/C=C/C(F)(F)COC(C)C.
What is the InChIKey of (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene?
The InChIKey is QTPIHMOKDYWYTL-CSKARUKUSA-N. The full InChI is InChI=1S/C14H26F2O/c1-12(2)9-7-5-6-8-10-14(15,16)11-17-13(3)4/h8,10,12-13H,5-7,9,11H2,1-4H3/b10-8+.
What are the key properties of (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene?
(E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene has a molecular weight of 248.36 g/mol, XLogP of 4.82, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-difluoro-9-methyl-1-propan-2-yloxydec-3-ene is sourced from PubChem (CID 58275582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).