C23H36N2O5 — CID 58275601
ethyl (1S,4R,6R,7Z,14S)-18-methoxy-14-(methylamino)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 58275601) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl (1S,4R,6R,7Z,14S)-18-methoxy-14-(methylamino)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6R,7Z,14S)-18-methoxy-14-(methylamino)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 58275601 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | ethyl (1S,4R,6R,7Z,14S)-18-methoxy-14-(methylamino)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(=O)[C@@H]3CC(OC)CN3C(=O)[C@@H](NC)CCCCC/C=C\[C@H]1C2 |
| InChI | InChI=1S/C23H36N2O5/c1-4-30-22(28)23-13-16(23)10-8-6-5-7-9-11-18(24-2)21(27)25-15-17(29-3)12-19(25)20(26)14-23/h8,10,16-19,24H,4-7,9,11-15H2,1-3H3/b10-8-/t16-,17?,18-,19-,23+/m0/s1 |
| InChIKey | WJWQXXMQGGUAGG-GVSXDFHESA-N |
| XLogP | 2.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|