C22H41N3O11P2S2-2 — CID 58275674
[(2S,4R)-1-(6-aminohexanoyl)-4-[[(2S,4R)-4-hydroxy-1-[4-(methyldisulfanyl)butanoyl]pyrrolidin-2-yl]methoxy-oxidophosphoryl]oxypyrrolidin-2-yl]methyl methyl phosphate (PubChem CID 58275674) has the molecular formula C22H41N3O11P2S2-2 and a molecular weight of 649.66 g/mol. Its IUPAC name is [(2S,4R)-1-(6-aminohexanoyl)-4-[[(2S,4R)-4-hydroxy-1-[4-(methyldisulfanyl)butanoyl]pyrrolidin-2-yl]methoxy-oxidophosphoryl]oxypyrrolidin-2-yl]methyl methyl phosphate.
| Compound Name | [(2S,4R)-1-(6-aminohexanoyl)-4-[[(2S,4R)-4-hydroxy-1-[4-(methyldisulfanyl)butanoyl]pyrrolidin-2-yl]methoxy-oxidophosphoryl]oxypyrrolidin-2-yl]methyl methyl phosphate |
|---|---|
| PubChem CID | 58275674 |
| Molecular Formula | C22H41N3O11P2S2-2 |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | [(2S,4R)-1-(6-aminohexanoyl)-4-[[(2S,4R)-4-hydroxy-1-[4-(methyldisulfanyl)butanoyl]pyrrolidin-2-yl]methoxy-oxidophosphoryl]oxypyrrolidin-2-yl]methyl methyl phosphate |
| SMILES | COP(=O)([O-])OC[C@@H]1C[C@@H](OP(=O)([O-])OC[C@@H]2C[C@@H](O)CN2C(=O)CCCSSC)CN1C(=O)CCCCCN |
| InChI | InChI=1S/C22H43N3O11P2S2/c1-33-37(29,30)34-16-18-12-20(14-25(18)21(27)7-4-3-5-9-23)36-38(31,32)35-15-17-11-19(26)13-24(17)22(28)8-6-10-40-39-2/h17-20,26H,3-16,23H2,1-2H3,(H,29,30)(H,31,32)/p-2/t17-,18-,19+,20+/m0/s1 |
| InChIKey | YIAWYWVMURGDAR-VNTMZGSJSA-L |
| XLogP | 0.86 |
| TPSA | 204.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|