About 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one
1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one (PubChem CID 58275718) has the molecular formula C22H43NO
and a molecular weight of 337.59 g/mol. Its IUPAC name is 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one.
Molecular Properties
| Compound Name | 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one |
| PubChem CID | 58275718 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one |
| SMILES | C=C(CCCCCCC(=O)CCCCCNC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H43NO/c1-19(21(2,3)4)15-11-8-9-12-16-20(24)17-13-10-14-18-23-22(5,6)7/h23H,1,8-18H2,2-7H3 |
| InChIKey | KIOVUKQSBFPWDL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one?
The IUPAC name of 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one (CID 58275718) is 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one.
What is the SMILES notation for 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one?
The canonical SMILES for 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one is C=C(CCCCCCC(=O)CCCCCNC(C)(C)C)C(C)(C)C.
What is the InChIKey of 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one?
The InChIKey is KIOVUKQSBFPWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43NO/c1-19(21(2,3)4)15-11-8-9-12-16-20(24)17-13-10-14-18-23-22(5,6)7/h23H,1,8-18H2,2-7H3.
What are the key properties of 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one?
1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one has a molecular weight of 337.59 g/mol, XLogP of 6.45, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tert-butylamino)-14,14-dimethyl-13-methylidenepentadecan-6-one is sourced from PubChem (CID 58275718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).