C22H41N3O11P2S2-2 — CID 58275743
[(3R)-1-(6-aminohexanoyl)-5-[[2-hydroxyethoxy(oxido)phosphinothioyl]oxymethyl]pyrrolidin-3-yl] [(4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methyl phosphate (PubChem CID 58275743) has the molecular formula C22H41N3O11P2S2-2 and a molecular weight of 649.66 g/mol. Its IUPAC name is [(3R)-1-(6-aminohexanoyl)-5-[[2-hydroxyethoxy(oxido)phosphinothioyl]oxymethyl]pyrrolidin-3-yl] [(4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methyl phosphate.
| Compound Name | [(3R)-1-(6-aminohexanoyl)-5-[[2-hydroxyethoxy(oxido)phosphinothioyl]oxymethyl]pyrrolidin-3-yl] [(4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 58275743 |
| Molecular Formula | C22H41N3O11P2S2-2 |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | [(3R)-1-(6-aminohexanoyl)-5-[[2-hydroxyethoxy(oxido)phosphinothioyl]oxymethyl]pyrrolidin-3-yl] [(4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methyl phosphate |
| SMILES | NCCCCCC(=O)N1C[C@H](OP(=O)([O-])OCC2C[C@@H](O)CN2C(=O)CCCS)CC1COP([O-])(=S)OCCO |
| InChI | InChI=1S/C22H43N3O11P2S2/c23-7-3-1-2-5-21(28)25-14-20(12-18(25)16-35-38(32,40)33-9-8-26)36-37(30,31)34-15-17-11-19(27)13-24(17)22(29)6-4-10-39/h17-20,26-27,39H,1-16,23H2,(H,30,31)(H,32,40)/p-2/t17?,18?,19-,20-,38?/m1/s1 |
| InChIKey | QPMMWRFXIFPPOJ-PGQNYBILSA-L |
| XLogP | -0.74 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|