C23H44N4O11P2S2-2 — CID 58275768
[(2S,4R)-4-[[(2S,4R)-1-[4-(2-aminoethyldisulfanyl)butanoyl]-4-hydroxypyrrolidin-2-yl]methoxy-oxidophosphoryl]oxy-1-(6-aminohexanoyl)pyrrolidin-2-yl]methyl methyl phosphate (PubChem CID 58275768) has the molecular formula C23H44N4O11P2S2-2 and a molecular weight of 678.70 g/mol. Its IUPAC name is [(2S,4R)-4-[[(2S,4R)-1-[4-(2-aminoethyldisulfanyl)butanoyl]-4-hydroxypyrrolidin-2-yl]methoxy-oxidophosphoryl]oxy-1-(6-aminohexanoyl)pyrrolidin-2-yl]methyl methyl phosphate.
| Compound Name | [(2S,4R)-4-[[(2S,4R)-1-[4-(2-aminoethyldisulfanyl)butanoyl]-4-hydroxypyrrolidin-2-yl]methoxy-oxidophosphoryl]oxy-1-(6-aminohexanoyl)pyrrolidin-2-yl]methyl methyl phosphate |
|---|---|
| PubChem CID | 58275768 |
| Molecular Formula | C23H44N4O11P2S2-2 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | [(2S,4R)-4-[[(2S,4R)-1-[4-(2-aminoethyldisulfanyl)butanoyl]-4-hydroxypyrrolidin-2-yl]methoxy-oxidophosphoryl]oxy-1-(6-aminohexanoyl)pyrrolidin-2-yl]methyl methyl phosphate |
| SMILES | COP(=O)([O-])OC[C@@H]1C[C@@H](OP(=O)([O-])OC[C@@H]2C[C@@H](O)CN2C(=O)CCCSSCCN)CN1C(=O)CCCCCN |
| InChI | InChI=1S/C23H46N4O11P2S2/c1-35-39(31,32)36-17-19-13-21(15-27(19)22(29)6-3-2-4-8-24)38-40(33,34)37-16-18-12-20(28)14-26(18)23(30)7-5-10-41-42-11-9-25/h18-21,28H,2-17,24-25H2,1H3,(H,31,32)(H,33,34)/p-2/t18-,19-,20+,21+/m0/s1 |
| InChIKey | YQTXRXPGWZTSDP-UWHLTILDSA-L |
| XLogP | 0.19 |
| TPSA | 230.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|