C27H40O6 — CID 58275930
[(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2,3-dimethoxy-5-methyl-4-oxocyclohex-2-en-1-yl] acetate (PubChem CID 58275930) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2,3-dimethoxy-5-methyl-4-oxocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2,3-dimethoxy-5-methyl-4-oxocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 58275930 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2,3-dimethoxy-5-methyl-4-oxocyclohex-2-en-1-yl] acetate |
| SMILES | C=C1OC(C/C(C)=C/CC/C(C)=C/C[C@@H]2C(C)C(=O)C(OC)=C(OC)[C@@H]2OC(C)=O)CC1C |
| InChI | InChI=1S/C27H40O6/c1-16(10-9-11-17(2)14-22-15-18(3)20(5)32-22)12-13-23-19(4)24(29)26(30-7)27(31-8)25(23)33-21(6)28/h11-12,18-19,22-23,25H,5,9-10,13-15H2,1-4,6-8H3/b16-12+,17-11+/t18?,19?,22?,23-,25-/m1/s1 |
| InChIKey | BLHPYHINNAGOBK-KKTTXNOLSA-N |
| XLogP | 5.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|