About 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione
2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione (PubChem CID 58275977) has the molecular formula C3H3FO4S
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione.
Molecular Properties
| Compound Name | 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione |
| PubChem CID | 58275977 |
| Molecular Formula | C3H3FO4S |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 153.97 |
| IUPAC Name | 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione |
| SMILES | CS1(F)OC(=O)C(=O)O1 |
| InChI | InChI=1S/C3H3FO4S/c1-9(4)7-2(5)3(6)8-9/h1H3 |
| InChIKey | ODRJVBDFALDTIS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione?
The IUPAC name of 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione (CID 58275977) is 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione.
What is the SMILES notation for 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione?
The canonical SMILES for 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione is CS1(F)OC(=O)C(=O)O1.
What is the InChIKey of 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione?
The InChIKey is ODRJVBDFALDTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3FO4S/c1-9(4)7-2(5)3(6)8-9/h1H3.
What are the key properties of 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione?
2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione has a molecular weight of 154.12 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-methyl-1,3,2-dioxathiolane-4,5-dione is sourced from PubChem (CID 58275977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).