About [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate
[(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate (PubChem CID 58276056) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate.
Molecular Properties
| Compound Name | [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate |
| PubChem CID | 58276056 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate |
| SMILES | CCC(=O)O/N=C1\CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C14H17NO2/c1-3-14(16)17-15-13-6-4-5-11-9-10(2)7-8-12(11)13/h7-9H,3-6H2,1-2H3/b15-13+ |
| InChIKey | OVZXAFLMNNQYEP-FYWRMAATSA-N |
| XLogP | 2.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate?
The IUPAC name of [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate (CID 58276056) is [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate.
What is the SMILES notation for [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate?
The canonical SMILES for [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate is CCC(=O)O/N=C1\CCCc2cc(C)ccc21.
What is the InChIKey of [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate?
The InChIKey is OVZXAFLMNNQYEP-FYWRMAATSA-N. The full InChI is InChI=1S/C14H17NO2/c1-3-14(16)17-15-13-6-4-5-11-9-10(2)7-8-12(11)13/h7-9H,3-6H2,1-2H3/b15-13+.
What are the key properties of [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate?
[(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate has a molecular weight of 231.29 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(6-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] propanoate is sourced from PubChem (CID 58276056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).