C16H35NSiTi — CID 58276178
tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;titanium(2+) (PubChem CID 58276178) has the molecular formula C16H35NSiTi and a molecular weight of 317.42 g/mol. Its IUPAC name is tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;titanium(2+).
| Compound Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;titanium(2+) |
|---|---|
| PubChem CID | 58276178 |
| Molecular Formula | C16H35NSiTi |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;titanium(2+) |
| SMILES | CC1C(C)C(C)C([Si](C)(C)[N-]C(C)(C)C)C1C.[CH3-].[Ti+2] |
| InChI | InChI=1S/C15H32NSi.CH3.Ti/c1-10-11(2)13(4)14(12(10)3)17(8,9)16-15(5,6)7;;/h10-14H,1-9H3;1H3;/q2*-1;+2 |
| InChIKey | WDOIVKQKEBCAPE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|