C21H19F2N3O3 — CID 58276236
[3-[4-(2,4-difluoro-3-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 58276236) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is [3-[4-(2,4-difluoro-3-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[4-(2,4-difluoro-3-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58276236 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [3-[4-(2,4-difluoro-3-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cnc(-c2ccc(-c3ccc(F)c(C=O)c3F)cc2)n1 |
| InChI | InChI=1S/C21H19F2N3O3/c1-21(2,3)20(28)29-12-26-11-24-19(25-26)14-6-4-13(5-7-14)15-8-9-17(22)16(10-27)18(15)23/h4-11H,12H2,1-3H3 |
| InChIKey | APTFXFACPPDAKY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|