C17H17BF2O2 — CID 58276287
[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3,5-difluorophenyl]boronic acid (PubChem CID 58276287) has the molecular formula C17H17BF2O2 and a molecular weight of 302.13 g/mol. Its IUPAC name is [4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3,5-difluorophenyl]boronic acid.
| Compound Name | [4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3,5-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 58276287 |
| Molecular Formula | C17H17BF2O2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3,5-difluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)c(CCC2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C17H17BF2O2/c19-16-9-14(18(21)22)10-17(20)15(16)6-5-11-7-12-3-1-2-4-13(12)8-11/h1-4,9-11,21-22H,5-8H2 |
| InChIKey | JFRPJXKQSHCPDZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|