C23H27FN4 — CID 58276436
2-cyclohexyl-N-[[3-[2-fluoro-4-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine (PubChem CID 58276436) has the molecular formula C23H27FN4 and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[3-[2-fluoro-4-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine.
| Compound Name | 2-cyclohexyl-N-[[3-[2-fluoro-4-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 58276436 |
| Molecular Formula | C23H27FN4 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-cyclohexyl-N-[[3-[2-fluoro-4-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine |
| SMILES | Fc1cc(-c2ncn[nH]2)ccc1-c1cccc(CNCCC2CCCCC2)c1 |
| InChI | InChI=1S/C23H27FN4/c24-22-14-20(23-26-16-27-28-23)9-10-21(22)19-8-4-7-18(13-19)15-25-12-11-17-5-2-1-3-6-17/h4,7-10,13-14,16-17,25H,1-3,5-6,11-12,15H2,(H,26,27,28) |
| InChIKey | BFPFTFBRDLVGRZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|