About 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide
3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide (PubChem CID 58276456) has the molecular formula C25H25NO
and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide.
Molecular Properties
| Compound Name | 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide |
| PubChem CID | 58276456 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(-c2ccc(CCC3Cc4ccccc4C3)cc2)c1 |
| InChI | InChI=1S/C25H25NO/c1-17-12-23(16-24(13-17)25(26)27)20-10-8-18(9-11-20)6-7-19-14-21-4-2-3-5-22(21)15-19/h2-5,8-13,16,19H,6-7,14-15H2,1H3,(H2,26,27) |
| InChIKey | IBDHTDDQYRJJMQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide?
The IUPAC name of 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide (CID 58276456) is 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide.
What is the SMILES notation for 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide?
The canonical SMILES for 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide is Cc1cc(C(N)=O)cc(-c2ccc(CCC3Cc4ccccc4C3)cc2)c1.
What is the InChIKey of 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide?
The InChIKey is IBDHTDDQYRJJMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO/c1-17-12-23(16-24(13-17)25(26)27)20-10-8-18(9-11-20)6-7-19-14-21-4-2-3-5-22(21)15-19/h2-5,8-13,16,19H,6-7,14-15H2,1H3,(H2,26,27).
What are the key properties of 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide?
3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide has a molecular weight of 355.48 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]-5-methylbenzamide is sourced from PubChem (CID 58276456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).