C21H20FN3O3 — CID 58276506
[3-[2-fluoro-3-(4-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 58276506) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is [3-[2-fluoro-3-(4-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[2-fluoro-3-(4-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58276506 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [3-[2-fluoro-3-(4-formylphenyl)phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cnc(-c2cccc(-c3ccc(C=O)cc3)c2F)n1 |
| InChI | InChI=1S/C21H20FN3O3/c1-21(2,3)20(27)28-13-25-12-23-19(24-25)17-6-4-5-16(18(17)22)15-9-7-14(11-26)8-10-15/h4-12H,13H2,1-3H3 |
| InChIKey | UNHUZPGQDBJVES-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|