About 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one
5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one (PubChem CID 58277509) has the molecular formula C21H19FINO4
and a molecular weight of 495.29 g/mol. Its IUPAC name is 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one |
| PubChem CID | 58277509 |
| Molecular Formula | C21H19FINO4 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one |
| SMILES | C=COCCOCC(=O)c1cc2c(cc1Cc1ccc(I)cc1F)C(=O)NC2 |
| InChI | InChI=1S/C21H19FINO4/c1-2-27-5-6-28-12-20(25)17-9-15-11-24-21(26)18(15)8-14(17)7-13-3-4-16(23)10-19(13)22/h2-4,8-10H,1,5-7,11-12H2,(H,24,26) |
| InChIKey | NXNBJAAFRZJGBU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one (CID 58277509) is 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one is C=COCCOCC(=O)c1cc2c(cc1Cc1ccc(I)cc1F)C(=O)NC2.
What is the InChIKey of 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one?
The InChIKey is NXNBJAAFRZJGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FINO4/c1-2-27-5-6-28-12-20(25)17-9-15-11-24-21(26)18(15)8-14(17)7-13-3-4-16(23)10-19(13)22/h2-4,8-10H,1,5-7,11-12H2,(H,24,26).
What are the key properties of 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one?
5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one has a molecular weight of 495.29 g/mol, XLogP of 3.62, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-ethenoxyethoxy)acetyl]-6-[(2-fluoro-4-iodophenyl)methyl]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 58277509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).