C27H27Cl2N7O5 — CID 58277769
(2S)-2-[[5,7-dichloro-2-(1H-indazole-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(3S)-4-hydroxy-1-(isocyanoamino)-3-methylbutylidene]amino]propanoic acid (PubChem CID 58277769) has the molecular formula C27H27Cl2N7O5 and a molecular weight of 600.46 g/mol. Its IUPAC name is (2S)-2-[[5,7-dichloro-2-(1H-indazole-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(3S)-4-hydroxy-1-(isocyanoamino)-3-methylbutylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[[5,7-dichloro-2-(1H-indazole-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(3S)-4-hydroxy-1-(isocyanoamino)-3-methylbutylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 58277769 |
| Molecular Formula | C27H27Cl2N7O5 |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | (2S)-2-[[5,7-dichloro-2-(1H-indazole-6-carbonyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(3S)-4-hydroxy-1-(isocyanoamino)-3-methylbutylidene]amino]propanoic acid |
| SMILES | [C-]#[N+]N/C(C[C@H](C)CO)=N/C[C@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C(=O)c1ccc3cn[nH]c3c1)C2)C(=O)O |
| InChI | InChI=1S/C27H27Cl2N7O5/c1-14(13-37)7-22(35-30-2)31-11-21(27(40)41)33-25(38)23-19(28)8-17-12-36(6-5-18(17)24(23)29)26(39)15-3-4-16-10-32-34-20(16)9-15/h3-4,8-10,14,21,37H,5-7,11-13H2,1H3,(H,31,35)(H,32,34)(H,33,38)(H,40,41)/t14-,21-/m0/s1 |
| InChIKey | WEFWBHOYYRSQFU-QKKBWIMNSA-N |
| XLogP | 3.09 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|