C21H24FN3O — CID 58277842
N-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)methyl]-2-fluoropyridine-4-carboxamide (PubChem CID 58277842) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)methyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)methyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 58277842 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)methyl]-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)CCN(C1CCC1)CC2)c1ccnc(F)c1 |
| InChI | InChI=1S/C21H24FN3O/c22-20-13-18(6-9-23-20)21(26)24-14-15-4-5-16-7-10-25(19-2-1-3-19)11-8-17(16)12-15/h4-6,9,12-13,19H,1-3,7-8,10-11,14H2,(H,24,26) |
| InChIKey | BGZNRYNCLYRTKF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|