C13H13F3N2O — CID 58277854
2,2,2-trifluoro-1-(7-methanimidoyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone (PubChem CID 58277854) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(7-methanimidoyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(7-methanimidoyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone |
|---|---|
| PubChem CID | 58277854 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2,2,2-trifluoro-1-(7-methanimidoyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone |
| SMILES | [H]/N=C/c1ccc2c(c1)CCN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)12(19)18-5-3-10-2-1-9(8-17)7-11(10)4-6-18/h1-2,7-8,17H,3-6H2/b17-8+ |
| InChIKey | DJVCLTFJHKSHNI-CAOOACKPSA-N |
| XLogP | 2.17 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|