C24H33N5O — CID 58278123
5-amino-7-(butylamino)-1-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-2,4-dihydro-1,6-naphthyridin-3-one (PubChem CID 58278123) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-amino-7-(butylamino)-1-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-2,4-dihydro-1,6-naphthyridin-3-one.
| Compound Name | 5-amino-7-(butylamino)-1-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-2,4-dihydro-1,6-naphthyridin-3-one |
|---|---|
| PubChem CID | 58278123 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 5-amino-7-(butylamino)-1-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-2,4-dihydro-1,6-naphthyridin-3-one |
| SMILES | CCCCNc1cc2c(c(N)n1)CC(=O)CN2Cc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C24H33N5O/c1-2-3-9-26-23-14-22-21(24(25)27-23)13-20(30)17-29(22)16-19-8-6-7-18(12-19)15-28-10-4-5-11-28/h6-8,12,14H,2-5,9-11,13,15-17H2,1H3,(H3,25,26,27) |
| InChIKey | FAAFFLDEBZYBQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|