About 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide
2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide (PubChem CID 58279357) has the molecular formula C20H12F2N4O3
and a molecular weight of 394.34 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide |
| PubChem CID | 58279357 |
| Molecular Formula | C20H12F2N4O3 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1cccc2[nH]c(-c3cccc4c3OC(F)(F)O4)nc12 |
| InChI | InChI=1S/C20H12F2N4O3/c21-20(22)28-15-8-2-6-13(17(15)29-20)18-25-14-7-1-5-12(16(14)26-18)19(27)24-11-4-3-9-23-10-11/h1-10H,(H,24,27)(H,25,26) |
| InChIKey | MFSANNBGBPHNRJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide?
The IUPAC name of 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide (CID 58279357) is 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide?
The canonical SMILES for 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide is O=C(Nc1cccnc1)c1cccc2[nH]c(-c3cccc4c3OC(F)(F)O4)nc12.
What is the InChIKey of 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide?
The InChIKey is MFSANNBGBPHNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F2N4O3/c21-20(22)28-15-8-2-6-13(17(15)29-20)18-25-14-7-1-5-12(16(14)26-18)19(27)24-11-4-3-9-23-10-11/h1-10H,(H,24,27)(H,25,26).
What are the key properties of 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide?
2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide has a molecular weight of 394.34 g/mol, XLogP of 4.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-pyridin-3-yl-1H-benzimidazole-4-carboxamide is sourced from PubChem (CID 58279357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).