C5H2Cl2N4 — CID 58279533
2,4-dichloroimidazo[2,1-f][1,2,4]triazine (PubChem CID 58279533) has the molecular formula C5H2Cl2N4 and a molecular weight of 189.01 g/mol. Its IUPAC name is 2,4-dichloroimidazo[2,1-f][1,2,4]triazine.
| Compound Name | 2,4-dichloroimidazo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 58279533 |
| Molecular Formula | C5H2Cl2N4 |
| Molecular Weight | 189.01 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 2,4-dichloroimidazo[2,1-f][1,2,4]triazine |
| SMILES | Clc1nc(Cl)c2nccn2n1 |
| InChI | InChI=1S/C5H2Cl2N4/c6-3-4-8-1-2-11(4)10-5(7)9-3/h1-2H |
| InChIKey | JJZFAZQVYQBMES-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.01 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |