About N-(2,6-difluorophenyl)methanethioamide
N-(2,6-difluorophenyl)methanethioamide (PubChem CID 58279656) has the molecular formula C7H5F2NS
and a molecular weight of 173.19 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)methanethioamide.
Molecular Properties
| Compound Name | N-(2,6-difluorophenyl)methanethioamide |
| PubChem CID | 58279656 |
| Molecular Formula | C7H5F2NS |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | N-(2,6-difluorophenyl)methanethioamide |
| SMILES | Fc1cccc(F)c1NC=S |
| InChI | InChI=1S/C7H5F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-4H,(H,10,11) |
| InChIKey | IEKZSOLFZIUTAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-difluorophenyl)methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-difluorophenyl)methanethioamide?
The IUPAC name of N-(2,6-difluorophenyl)methanethioamide (CID 58279656) is N-(2,6-difluorophenyl)methanethioamide.
What is the SMILES notation for N-(2,6-difluorophenyl)methanethioamide?
The canonical SMILES for N-(2,6-difluorophenyl)methanethioamide is Fc1cccc(F)c1NC=S.
What is the InChIKey of N-(2,6-difluorophenyl)methanethioamide?
The InChIKey is IEKZSOLFZIUTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-4H,(H,10,11).
What are the key properties of N-(2,6-difluorophenyl)methanethioamide?
N-(2,6-difluorophenyl)methanethioamide has a molecular weight of 173.19 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-difluorophenyl)methanethioamide is sourced from PubChem (CID 58279656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).