C9H11NO4 — CID 58279944
(1S,2R,6S,7R,8S,9S)-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 58279944) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S,9S)-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S,9S)-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 58279944 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (1S,2R,6S,7R,8S,9S)-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@H]3C[C@H]([C@H](O)[C@H]3O)[C@@H]12 |
| InChI | InChI=1S/C9H11NO4/c11-6-2-1-3(7(6)12)5-4(2)8(13)10-9(5)14/h2-7,11-12H,1H2,(H,10,13,14)/t2-,3+,4+,5-,6-,7-/m0/s1 |
| InChIKey | CHDWSHSRBHWOOL-ARYBSUEZSA-N |
| XLogP | -1.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|