C9H9F4NO — CID 58280007
2-fluoro-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-3-ol (PubChem CID 58280007) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 2-fluoro-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-3-ol.
| Compound Name | 2-fluoro-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 58280007 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-fluoro-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-3-ol |
| SMILES | CC(C)(c1ccc(O)c(F)n1)C(F)(F)F |
| InChI | InChI=1S/C9H9F4NO/c1-8(2,9(11,12)13)6-4-3-5(15)7(10)14-6/h3-4,15H,1-2H3 |
| InChIKey | ONRORCFYNWBZPO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|