C16H12ClN3O3 — CID 58280035
N-[3-chloro-4-(2,5-dioxopyrrolidin-1-yl)phenyl]pyridine-4-carboxamide (PubChem CID 58280035) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is N-[3-chloro-4-(2,5-dioxopyrrolidin-1-yl)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-chloro-4-(2,5-dioxopyrrolidin-1-yl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58280035 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[3-chloro-4-(2,5-dioxopyrrolidin-1-yl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)CCC2=O)c(Cl)c1)c1ccncc1 |
| InChI | InChI=1S/C16H12ClN3O3/c17-12-9-11(19-16(23)10-5-7-18-8-6-10)1-2-13(12)20-14(21)3-4-15(20)22/h1-2,5-9H,3-4H2,(H,19,23) |
| InChIKey | OVBZSEKCZKLEDV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|