About methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate
methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate (PubChem CID 58280177) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate |
| PubChem CID | 58280177 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1C[C@H](O)CCN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13(14-6-4-3-5-7-14)18-11-10-16(19)12-15(18)8-9-17(20)21-2/h3-9,13,15-16,19H,10-12H2,1-2H3/b9-8+/t13-,15-,16-/m1/s1 |
| InChIKey | CHCUMDCPLDAJOC-TVTKMGCBSA-N |
| XLogP | 2.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate?
The IUPAC name of methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate (CID 58280177) is methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate is COC(=O)/C=C/[C@@H]1C[C@H](O)CCN1[C@H](C)c1ccccc1.
What is the InChIKey of methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate?
The InChIKey is CHCUMDCPLDAJOC-TVTKMGCBSA-N. The full InChI is InChI=1S/C17H23NO3/c1-13(14-6-4-3-5-7-14)18-11-10-16(19)12-15(18)8-9-17(20)21-2/h3-9,13,15-16,19H,10-12H2,1-2H3/b9-8+/t13-,15-,16-/m1/s1.
What are the key properties of methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate?
methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate has a molecular weight of 289.38 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(2S,4R)-4-hydroxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]prop-2-enoate is sourced from PubChem (CID 58280177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).