About dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+)
dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) (PubChem CID 58280496) has the molecular formula C11H20N2W
and a molecular weight of 364.14 g/mol. Its IUPAC name is dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+).
Molecular Properties
| Compound Name | dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) |
| PubChem CID | 58280496 |
| Molecular Formula | C11H20N2W |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) |
| SMILES | CCn1c(C)[c-]c(C)c1C.C[N-]C.[W+2] |
| InChI | InChI=1S/C9H14N.C2H6N.W/c1-5-10-8(3)6-7(2)9(10)4;1-3-2;/h5H2,1-4H3;1-2H3;/q2*-1;+2 |
| InChIKey | MVXJRUVGNBTJIL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 19.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+)?
The IUPAC name of dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) (CID 58280496) is dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+).
What is the SMILES notation for dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+)?
The canonical SMILES for dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) is CCn1c(C)[c-]c(C)c1C.C[N-]C.[W+2].
What is the InChIKey of dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+)?
The InChIKey is MVXJRUVGNBTJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N.C2H6N.W/c1-5-10-8(3)6-7(2)9(10)4;1-3-2;/h5H2,1-4H3;1-2H3;/q2*-1;+2.
What are the key properties of dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+)?
dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) has a molecular weight of 364.14 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanide;1-ethyl-2,4,5-trimethyl-3H-pyrrol-3-ide;tungsten(2+) is sourced from PubChem (CID 58280496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).