C33H37FN2O5 — CID 58280598
(3R,5R)-7-[4-(cyclohexa-2,4-dien-1-ylcarbamoyl)-2-(4-fluorophenyl)-3-phenyl-5-propan-2-ylpyrrol-1-yl]-2,2-dideuterio-3,5-dihydroxyheptanoic acid (PubChem CID 58280598) has the molecular formula C33H37FN2O5 and a molecular weight of 562.68 g/mol. Its IUPAC name is (3R,5R)-7-[4-(cyclohexa-2,4-dien-1-ylcarbamoyl)-2-(4-fluorophenyl)-3-phenyl-5-propan-2-ylpyrrol-1-yl]-2,2-dideuterio-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[4-(cyclohexa-2,4-dien-1-ylcarbamoyl)-2-(4-fluorophenyl)-3-phenyl-5-propan-2-ylpyrrol-1-yl]-2,2-dideuterio-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 58280598 |
| Molecular Formula | C33H37FN2O5 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | (3R,5R)-7-[4-(cyclohexa-2,4-dien-1-ylcarbamoyl)-2-(4-fluorophenyl)-3-phenyl-5-propan-2-ylpyrrol-1-yl]-2,2-dideuterio-3,5-dihydroxyheptanoic acid |
| SMILES | [2H]C([2H])(C(=O)O)[C@H](O)C[C@H](O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)NC2C=CC=CC2)c1C(C)C |
| InChI | InChI=1S/C33H37FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-11,13-16,21,25-27,37-38H,12,17-20H2,1-2H3,(H,35,41)(H,39,40)/t25?,26-,27-/m1/s1/i20D2 |
| InChIKey | DBTCQYUTKORDBC-LPAWDTBKSA-N |
| XLogP | 5.68 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |