C29H14F6O4 — CID 58280705
2-[1,1,1,3,3,3-hexafluoro-2-(9-oxoxanthen-2-yl)propan-2-yl]xanthen-9-one (PubChem CID 58280705) has the molecular formula C29H14F6O4 and a molecular weight of 540.42 g/mol. Its IUPAC name is 2-[1,1,1,3,3,3-hexafluoro-2-(9-oxoxanthen-2-yl)propan-2-yl]xanthen-9-one.
| Compound Name | 2-[1,1,1,3,3,3-hexafluoro-2-(9-oxoxanthen-2-yl)propan-2-yl]xanthen-9-one |
|---|---|
| PubChem CID | 58280705 |
| Molecular Formula | C29H14F6O4 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 2-[1,1,1,3,3,3-hexafluoro-2-(9-oxoxanthen-2-yl)propan-2-yl]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2ccc(C(c3ccc4oc5ccccc5c(=O)c4c3)(C(F)(F)F)C(F)(F)F)cc12 |
| InChI | InChI=1S/C29H14F6O4/c30-28(31,32)27(29(33,34)35,15-9-11-23-19(13-15)25(36)17-5-1-3-7-21(17)38-23)16-10-12-24-20(14-16)26(37)18-6-2-4-8-22(18)39-24/h1-14H |
| InChIKey | MASCODZEVGPKJA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|