C49H49IrN5-2 — CID 58280763
2,4-bis(4-tert-butylphenyl)-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium (PubChem CID 58280763) has the molecular formula C49H49IrN5-2 and a molecular weight of 900.18 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 58280763 |
| Molecular Formula | C49H49IrN5-2 |
| Molecular Weight | 900.18 g/mol |
| Exact Mass | 900.36 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium |
| SMILES | CC(C)(C)c1c[c-]c(-c2ccccn2)cc1.CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(-c4[c-]cccc4)nc3)n2)cc1.[Ir] |
| InChI | InChI=1S/C34H33N4.C15H16N.Ir/c1-33(2,3)27-17-12-24(13-18-27)30-36-31(25-14-19-28(20-15-25)34(4,5)6)38-32(37-30)26-16-21-29(35-22-26)23-10-8-7-9-11-23;1-15(2,3)13-9-7-12(8-10-13)14-6-4-5-11-16-14;/h7-10,12-22H,1-6H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | YAQXSTXJSSMGHC-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.18 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|