C57H49IrN5-2 — CID 58280777
2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium;2-phenylpyridine (PubChem CID 58280777) has the molecular formula C57H49IrN5-2 and a molecular weight of 996.27 g/mol. Its IUPAC name is 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium;2-phenylpyridine.
| Compound Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 58280777 |
| Molecular Formula | C57H49IrN5-2 |
| Molecular Weight | 996.27 g/mol |
| Exact Mass | 996.36 |
| IUPAC Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(C(C)(C)C)cc5)cc4)nc(-c4ccc(-c5[c-]cccc5)nc4)n3)cc2)cc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C46H41N4.C11H8N.Ir/c1-45(2,3)39-25-20-33(21-26-39)31-12-16-36(17-13-31)42-48-43(37-18-14-32(15-19-37)34-22-27-40(28-23-34)46(4,5)6)50-44(49-42)38-24-29-41(47-30-38)35-10-8-7-9-11-35;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h7-10,12-30H,1-6H3;1-6,8-9H;/q2*-1; |
| InChIKey | BZRCHRUCFKSZRL-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.27 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|