C20H32O2 — CID 58280984
2,5,7,8-tetramethyl-2-(5-methylhexyl)-3,4-dihydrochromen-6-ol (PubChem CID 58280984) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-(5-methylhexyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-(5-methylhexyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 58280984 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-(5-methylhexyl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCC(C)C)O2 |
| InChI | InChI=1S/C20H32O2/c1-13(2)9-7-8-11-20(6)12-10-17-16(5)18(21)14(3)15(4)19(17)22-20/h13,21H,7-12H2,1-6H3 |
| InChIKey | ZETYAIYEFKEIHP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|