C36H53N5O4S — CID 58281044
(2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-4-oxohexanamide (PubChem CID 58281044) has the molecular formula C36H53N5O4S and a molecular weight of 651.92 g/mol. Its IUPAC name is (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-4-oxohexanamide.
| Compound Name | (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 58281044 |
| Molecular Formula | C36H53N5O4S |
| Molecular Weight | 651.92 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-4-oxohexanamide |
| SMILES | CC(C)(C)Oc1ccc(C[C@H](CC(=O)[C@@H](N)CSC(C)(C)C)C(=O)NC(C)(C)[C@@H](Cc2ccccc2)C(=O)CCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C36H53N5O4S/c1-34(2,3)45-28-18-16-26(17-19-28)21-27(23-32(43)30(37)24-46-35(4,5)6)33(44)40-36(7,8)29(22-25-13-10-9-11-14-25)31(42)15-12-20-39-41-38/h9-11,13-14,16-19,27,29-30H,12,15,20-24,37H2,1-8H3,(H,40,44)/t27-,29+,30+/m1/s1 |
| InChIKey | AWVYTVCYCCZMDW-GGCFSWKVSA-N |
| XLogP | 7.25 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.92 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|