About 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine
2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine (PubChem CID 58281690) has the molecular formula C20H30N4
and a molecular weight of 326.49 g/mol. Its IUPAC name is 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine.
Molecular Properties
| Compound Name | 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine |
| PubChem CID | 58281690 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine |
| SMILES | CCCc1cc(CCC)nc(-c2c(CCC)ncnc2CCC)n1 |
| InChI | InChI=1S/C20H30N4/c1-5-9-15-13-16(10-6-2)24-20(23-15)19-17(11-7-3)21-14-22-18(19)12-8-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | DRGOJHICTJEJEM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine?
The IUPAC name of 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine (CID 58281690) is 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine.
What is the SMILES notation for 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine?
The canonical SMILES for 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine is CCCc1cc(CCC)nc(-c2c(CCC)ncnc2CCC)n1.
What is the InChIKey of 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine?
The InChIKey is DRGOJHICTJEJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4/c1-5-9-15-13-16(10-6-2)24-20(23-15)19-17(11-7-3)21-14-22-18(19)12-8-4/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine?
2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine has a molecular weight of 326.49 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dipropylpyrimidin-5-yl)-4,6-dipropylpyrimidine is sourced from PubChem (CID 58281690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).