About 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine
2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine (PubChem CID 58281694) has the molecular formula C32H54N4
and a molecular weight of 494.81 g/mol. Its IUPAC name is 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine.
Molecular Properties
| Compound Name | 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine |
| PubChem CID | 58281694 |
| Molecular Formula | C32H54N4 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.43 |
| IUPAC Name | 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine |
| SMILES | CCCCCCc1cc(CCCCCC)nc(-c2c(CCCCCC)ncnc2CCCCCC)n1 |
| InChI | InChI=1S/C32H54N4/c1-5-9-13-17-21-27-25-28(22-18-14-10-6-2)36-32(35-27)31-29(23-19-15-11-7-3)33-26-34-30(31)24-20-16-12-8-4/h25-26H,5-24H2,1-4H3 |
| InChIKey | PYQYKDSSRVBONE-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine?
The IUPAC name of 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine (CID 58281694) is 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine.
What is the SMILES notation for 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine?
The canonical SMILES for 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine is CCCCCCc1cc(CCCCCC)nc(-c2c(CCCCCC)ncnc2CCCCCC)n1.
What is the InChIKey of 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine?
The InChIKey is PYQYKDSSRVBONE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H54N4/c1-5-9-13-17-21-27-25-28(22-18-14-10-6-2)36-32(35-27)31-29(23-19-15-11-7-3)33-26-34-30(31)24-20-16-12-8-4/h25-26H,5-24H2,1-4H3.
What are the key properties of 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine?
2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine has a molecular weight of 494.81 g/mol, XLogP of 9.42, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dihexylpyrimidin-5-yl)-4,6-dihexylpyrimidine is sourced from PubChem (CID 58281694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).